What is the chemical name of acetone?
IUPAC Name | propan-2-one |
---|---|
Alternative Names | 2-propanone propanone Dimethyl ketone |
Molecular Formula | C3H6O |
Molar Mass | 58.08 g/mol |
InChI | InChI=1S/C3H6O/c1-3(2)4/h1-2H3 |
What is the structure of Ethanenitrile?
C₂H₃N
Acetonitrile/Formula
What is CH3COCH3?
IUPAC name of CH3COCH3 is acetone also known as propanone or dimethyl ketone . it is a colourless flammable liquid .
What is structural formula of acetone?
C3H6O
Acetone/Formula
Is CH3CN acid or base?
Acetonitrile (CH3CN) has a pKa of 25, making it more acidic than many other compounds having only…
Why does acetone have 3 carbons?
Because the carbonyl group in a ketone must be attached to two carbon groups, the simplest ketone has three carbon atoms. It is widely known as acetone, a unique name unrelated to other common names for ketones.
What is the structural formula of ethanol?
C2H5OH
Ethanol/Formula
The molecular formula of ethanol is C2H6O, indicating that ethanol contains two carbons and an oxygen. However, the structural formula of ethanol, C2H5OH, provides a little more detail, and indicates that there is an hydroxyl group (-OH) at the end of the 2-carbon chain (Figure 1.1).
What is the structural formula for 2 Methylpropane?
C4H10
Isobutane/Formula
What is the chemical formula for acetonitrile cyanomethane?
Acetonitrile PubChem CID 6342 Structure Find Similar Structures Chemical Safety Laboratory Chemical Safety Summary (LCSS Molecular Formula CH3CN or C2H3N Synonyms ACETONITRILE Cyanomethane Methyl cyanide
What are the chemical properties of acetonitrile?
Let us learn the chemical properties of Acetonitrile. Acetonitrile is an aliphatic nitrile and a volatile organic compound. Acetonitrile is less dense than water and its vapour is dense than air (Vapor pressure = 9.71 kPa). The structural formula of Acetonitrile is as shown below in the diagram.
Which is the SMILES string of acetonitrile?
The SMILES string of ACETONITRILE is CC#N, which can be can be imported by most molecule editors for conversion back into two-dimensional drawings or three-dimensional models of the ACETONITRILE.
How is acetonitrile used as a polar aprotic solvent?
Acetonitrile is used as a polar aprotic solvent in organic synthesis and purification of butadiene. Let us learn the chemical properties of Acetonitrile. Acetonitrile is an aliphatic nitrile and a volatile organic compound. Acetonitrile is less dense than water and its vapor is dense than air (Vapor pressure = 9.71 kPa).